10th Grade > Chemistry
CARBON AND ITS COMPOUNDS MCQs
Total Questions : 56
| Page 3 of 6 pages
Answer: Option D. -> Concentrated H2SO4
:
D
The given reaction is a dehydration reaction in which ethanol is when heated with concentrated sulphuric acid at 443 K givesethene and water.
In this reaction, conc.H2SO4 is used because it is a strong dehydrating agent. The reaction occurs as follows:
CH3CH2OH(aq)Hotconc.H2SO4−−−−−−−−−−→CH2=CH2(g)+H2O(l)
Therefore, X is concentrated sulphuric acid.
:
D
The given reaction is a dehydration reaction in which ethanol is when heated with concentrated sulphuric acid at 443 K givesethene and water.
In this reaction, conc.H2SO4 is used because it is a strong dehydrating agent. The reaction occurs as follows:
CH3CH2OH(aq)Hotconc.H2SO4−−−−−−−−−−→CH2=CH2(g)+H2O(l)
Therefore, X is concentrated sulphuric acid.
Answer: Option D. -> Triple bond > Double bond > Single bond
:
D
As the number ofsharedelectronsincreases, the bond strength increases.
In a triple bond, a total of6 electrons are shared. In a double bond, 4 electrons are shared and in a single bond, only 2 electrons are shared. Thus, the bond strength is as follows:
Triple bond > Double bond > Single bond.
:
D
As the number ofsharedelectronsincreases, the bond strength increases.
In a triple bond, a total of6 electrons are shared. In a double bond, 4 electrons are shared and in a single bond, only 2 electrons are shared. Thus, the bond strength is as follows:
Triple bond > Double bond > Single bond.
Answer: Option C. -> Butane
:
C
∙ The compound given has fourcarbon atoms so the word root for this compound is 'but'.
∙ Since all the carbon atoms are bonded to each other by only single bonds, this compound is an alkane and thesuffix in this case will be '-ane'.
Therefore, the name of this compound is butane.
:
C
∙ The compound given has fourcarbon atoms so the word root for this compound is 'but'.
∙ Since all the carbon atoms are bonded to each other by only single bonds, this compound is an alkane and thesuffix in this case will be '-ane'.
Therefore, the name of this compound is butane.
Answer: Option C. -> Carboxylic acids
:
C
Detergents are ammonium or sulphonate salts of long chain carboxylic acids. So the resulting compound is called sulphonic acid. Sulphonic acids are used in making detergents while carboxylic acids (fatty acids) are used in soap making processes.
:
C
Detergents are ammonium or sulphonate salts of long chain carboxylic acids. So the resulting compound is called sulphonic acid. Sulphonic acids are used in making detergents while carboxylic acids (fatty acids) are used in soap making processes.
Answer: Option B. ->
Diamond
:
B and D
:
B and D
Allotropy is the property of some chemical elements to exist in two or more forms.
Carbon monoxide and carbon dioxide are compounds formed by the different combinations of carbon and oxygen.
Allotropes of carbon contain only carbon atoms in them which are bonded in different manner. Examples: diamond, fullerene and graphite.
Answer: Option D. ->
Concentrated H2SO4
:
D
The given reaction is a dehydration reaction in which ethanol is when heated with concentrated sulphuric acid at 443 K gives ethene and water.
In this reaction, conc.H2SO4 is used because it is a strong dehydrating agent. The reaction occurs as follows:
CH3CH2OH(aq) Hot conc. H2SO4−−−−−−−−−−→ CH2=CH2(g) + H2O(l)
Therefore, X is concentrated sulphuric acid.
:
D
The given reaction is a dehydration reaction in which ethanol is when heated with concentrated sulphuric acid at 443 K gives ethene and water.
In this reaction, conc.H2SO4 is used because it is a strong dehydrating agent. The reaction occurs as follows:
CH3CH2OH(aq) Hot conc. H2SO4−−−−−−−−−−→ CH2=CH2(g) + H2O(l)
Therefore, X is concentrated sulphuric acid.
Answer: Option D. ->
Triple bond > Double bond > Single bond
:
D
:
D
As the number of shared electrons increases, the bond strength increases.
In a triple bond, a total of 6 electrons are shared. In a double bond, 4 electrons are shared and in a single bond, only 2 electrons are shared. Thus, the bond strength is as follows:
Triple bond > Double bond > Single bond.
Answer: Option D. ->
substitution reaction
:
D
A substitution reaction is a chemical reaction during which one atom or group of atoms in a chemical compound is replaced by another atom or group of atoms.
Chlorination of methane is a substitution reaction because chlorine atom replaces hydrogen atom from the methane molecule. The reaction occurs as follows:
CH4(g)+Cl2 (g)sunlight−−−−→CH3Cl (g)+HCl (g)Methane Chlorine Chloro Hydrogen methane chloride
:
D
A substitution reaction is a chemical reaction during which one atom or group of atoms in a chemical compound is replaced by another atom or group of atoms.
Chlorination of methane is a substitution reaction because chlorine atom replaces hydrogen atom from the methane molecule. The reaction occurs as follows:
CH4(g)+Cl2 (g)sunlight−−−−→CH3Cl (g)+HCl (g)Methane Chlorine Chloro Hydrogen methane chloride
Latest Videos
Latest Test Papers
Login With Google
Old way of Login
Login With Email